About 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile
2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile (PubChem CID 590533) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile.
Molecular Properties
| Compound Name | 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile |
| PubChem CID | 590533 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile |
| SMILES | N#CC/N=C/C1=CCCN(CC#N)C1 |
| InChI | InChI=1S/C10H12N4/c11-3-5-13-8-10-2-1-6-14(9-10)7-4-12/h2,8H,1,5-7,9H2/b13-8+ |
| InChIKey | KTGPWNNSAITCRK-MDWZMJQESA-N |
| XLogP | 0.74 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile?
The IUPAC name of 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile (CID 590533) is 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile.
What is the SMILES notation for 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile?
The canonical SMILES for 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile is N#CC/N=C/C1=CCCN(CC#N)C1.
What is the InChIKey of 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile?
The InChIKey is KTGPWNNSAITCRK-MDWZMJQESA-N. The full InChI is InChI=1S/C10H12N4/c11-3-5-13-8-10-2-1-6-14(9-10)7-4-12/h2,8H,1,5-7,9H2/b13-8+.
What are the key properties of 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile?
2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile has a molecular weight of 188.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(cyanomethyl)-3,6-dihydro-2H-pyridin-5-yl]methylideneamino]acetonitrile is sourced from PubChem (CID 590533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).