C24H18O4 — CID 59053380
3-(3,7-dimethyl-1,4-dioxonaphthalen-2-yl)-2,6-dimethylnaphthalene-1,4-dione (PubChem CID 59053380) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is 3-(3,7-dimethyl-1,4-dioxonaphthalen-2-yl)-2,6-dimethylnaphthalene-1,4-dione.
| Compound Name | 3-(3,7-dimethyl-1,4-dioxonaphthalen-2-yl)-2,6-dimethylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 59053380 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-(3,7-dimethyl-1,4-dioxonaphthalen-2-yl)-2,6-dimethylnaphthalene-1,4-dione |
| SMILES | CC1=C(C2=C(C)C(=O)c3ccc(C)cc3C2=O)C(=O)c2cc(C)ccc2C1=O |
| InChI | InChI=1S/C24H18O4/c1-11-5-7-15-17(9-11)23(27)19(13(3)21(15)25)20-14(4)22(26)16-8-6-12(2)10-18(16)24(20)28/h5-10H,1-4H3 |
| InChIKey | VDGMCXIYRLWMDY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|