About 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine
2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine (PubChem CID 59053780) has the molecular formula C20H13N3O
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine |
| PubChem CID | 59053780 |
| Molecular Formula | C20H13N3O |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine |
| SMILES | c1ccc(-c2cc3nccc(-c4c[nH]c5ncccc45)c3o2)cc1 |
| InChI | InChI=1S/C20H13N3O/c1-2-5-13(6-3-1)18-11-17-19(24-18)14(8-10-21-17)16-12-23-20-15(16)7-4-9-22-20/h1-12H,(H,22,23) |
| InChIKey | IREZXQMARXCQLR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine?
The IUPAC name of 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine (CID 59053780) is 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine.
What is the SMILES notation for 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine?
The canonical SMILES for 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine is c1ccc(-c2cc3nccc(-c4c[nH]c5ncccc45)c3o2)cc1.
What is the InChIKey of 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine?
The InChIKey is IREZXQMARXCQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13N3O/c1-2-5-13(6-3-1)18-11-17-19(24-18)14(8-10-21-17)16-12-23-20-15(16)7-4-9-22-20/h1-12H,(H,22,23).
What are the key properties of 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine?
2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine has a molecular weight of 311.34 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-7-(1H-pyrrolo[2,3-b]pyridin-3-yl)furo[3,2-b]pyridine is sourced from PubChem (CID 59053780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).