About 2-oxatricyclo[3.3.1.13,7]decan-5-ol
2-oxatricyclo[3.3.1.13,7]decan-5-ol (PubChem CID 59053799) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-oxatricyclo[3.3.1.13,7]decan-5-ol.
Molecular Properties
| Compound Name | 2-oxatricyclo[3.3.1.13,7]decan-5-ol |
| PubChem CID | 59053799 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-oxatricyclo[3.3.1.13,7]decan-5-ol |
| SMILES | OC12CC3CC(C1)OC(C3)C2 |
| InChI | InChI=1S/C9H14O2/c10-9-3-6-1-7(4-9)11-8(2-6)5-9/h6-8,10H,1-5H2 |
| InChIKey | NYNSDHIHRUKTBY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxatricyclo[3.3.1.13,7]decan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxatricyclo[3.3.1.13,7]decan-5-ol?
The IUPAC name of 2-oxatricyclo[3.3.1.13,7]decan-5-ol (CID 59053799) is 2-oxatricyclo[3.3.1.13,7]decan-5-ol.
What is the SMILES notation for 2-oxatricyclo[3.3.1.13,7]decan-5-ol?
The canonical SMILES for 2-oxatricyclo[3.3.1.13,7]decan-5-ol is OC12CC3CC(C1)OC(C3)C2.
What is the InChIKey of 2-oxatricyclo[3.3.1.13,7]decan-5-ol?
The InChIKey is NYNSDHIHRUKTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c10-9-3-6-1-7(4-9)11-8(2-6)5-9/h6-8,10H,1-5H2.
What are the key properties of 2-oxatricyclo[3.3.1.13,7]decan-5-ol?
2-oxatricyclo[3.3.1.13,7]decan-5-ol has a molecular weight of 154.21 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxatricyclo[3.3.1.13,7]decan-5-ol is sourced from PubChem (CID 59053799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).