About ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate
ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate (PubChem CID 59053801) has the molecular formula C20H27NO4S3
and a molecular weight of 441.64 g/mol. Its IUPAC name is ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate.
Molecular Properties
| Compound Name | ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate |
| PubChem CID | 59053801 |
| Molecular Formula | C20H27NO4S3 |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate |
| SMILES | CCOC(=O)C1CC2CN(S(=O)(=O)c3ccc(C)cc3)CC(C1)C21SCCS1 |
| InChI | InChI=1S/C20H27NO4S3/c1-3-25-19(22)15-10-16-12-21(13-17(11-15)20(16)26-8-9-27-20)28(23,24)18-6-4-14(2)5-7-18/h4-7,15-17H,3,8-13H2,1-2H3 |
| InChIKey | ALJVQCLOIPGSDJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate?
The IUPAC name of ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate (CID 59053801) is ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate.
What is the SMILES notation for ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate?
The canonical SMILES for ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate is CCOC(=O)C1CC2CN(S(=O)(=O)c3ccc(C)cc3)CC(C1)C21SCCS1.
What is the InChIKey of ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate?
The InChIKey is ALJVQCLOIPGSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO4S3/c1-3-25-19(22)15-10-16-12-21(13-17(11-15)20(16)26-8-9-27-20)28(23,24)18-6-4-14(2)5-7-18/h4-7,15-17H,3,8-13H2,1-2H3.
What are the key properties of ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate?
ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate has a molecular weight of 441.64 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3'-(4-methylphenyl)sulfonylspiro[1,3-dithiolane-2,9'-3-azabicyclo[3.3.1]nonane]-7'-carboxylate is sourced from PubChem (CID 59053801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).