C24H28F5N3O2 — CID 59053853
[4-(2-hydroxypropan-2-yl)phenyl]-[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)spiro[3,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-1'-yl]methanone (PubChem CID 59053853) has the molecular formula C24H28F5N3O2 and a molecular weight of 485.50 g/mol. Its IUPAC name is [4-(2-hydroxypropan-2-yl)phenyl]-[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)spiro[3,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-1'-yl]methanone.
| Compound Name | [4-(2-hydroxypropan-2-yl)phenyl]-[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)spiro[3,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 59053853 |
| Molecular Formula | C24H28F5N3O2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | [4-(2-hydroxypropan-2-yl)phenyl]-[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)spiro[3,4-dihydropyrrolo[1,2-a]pyrazine-1,4'-piperidine]-1'-yl]methanone |
| SMILES | CN1CCn2c(ccc2C(F)(F)C(F)(F)F)C12CCN(C(=O)c1ccc(C(C)(C)O)cc1)CC2 |
| InChI | InChI=1S/C24H28F5N3O2/c1-21(2,34)17-6-4-16(5-7-17)20(33)31-12-10-22(11-13-31)18-8-9-19(23(25,26)24(27,28)29)32(18)15-14-30(22)3/h4-9,34H,10-15H2,1-3H3 |
| InChIKey | QENPHQVTBGUAOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|