C19H28N4O3 — CID 59053917
2-(6-amino-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl)-N-(2-azatricyclo[3.3.1.13,7]decan-1-yl)acetamide (PubChem CID 59053917) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(6-amino-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl)-N-(2-azatricyclo[3.3.1.13,7]decan-1-yl)acetamide.
| Compound Name | 2-(6-amino-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl)-N-(2-azatricyclo[3.3.1.13,7]decan-1-yl)acetamide |
|---|---|
| PubChem CID | 59053917 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-(6-amino-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl)-N-(2-azatricyclo[3.3.1.13,7]decan-1-yl)acetamide |
| SMILES | NC1CC2OC1C1CN(CC(=O)NC34CC5CC(CC(C5)N3)C4)C(=O)C21 |
| InChI | InChI=1S/C19H28N4O3/c20-13-4-14-16-12(17(13)26-14)7-23(18(16)25)8-15(24)22-19-5-9-1-10(6-19)3-11(2-9)21-19/h9-14,16-17,21H,1-8,20H2,(H,22,24) |
| InChIKey | AURKSCOPMPVIKB-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |