C24H19NO6 — CID 59054087
7,17-dihydroxy-8,16-dimethoxy-12-prop-2-enyl-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one (PubChem CID 59054087) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is 7,17-dihydroxy-8,16-dimethoxy-12-prop-2-enyl-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one.
| Compound Name | 7,17-dihydroxy-8,16-dimethoxy-12-prop-2-enyl-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 59054087 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 7,17-dihydroxy-8,16-dimethoxy-12-prop-2-enyl-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one |
| SMILES | C=CCn1c2c3cc(OC)c(O)cc3ccc2c2c(=O)oc3cc(O)c(OC)cc3c21 |
| InChI | InChI=1S/C24H19NO6/c1-4-7-25-22-13(6-5-12-8-16(26)19(29-2)9-14(12)22)21-23(25)15-10-20(30-3)17(27)11-18(15)31-24(21)28/h4-6,8-11,26-27H,1,7H2,2-3H3 |
| InChIKey | IQMBILRPPOKBNZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|