C23H19NO6 — CID 59054153
12-ethyl-7,17-dihydroxy-8,16-dimethoxy-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one (PubChem CID 59054153) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 12-ethyl-7,17-dihydroxy-8,16-dimethoxy-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one.
| Compound Name | 12-ethyl-7,17-dihydroxy-8,16-dimethoxy-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 59054153 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 12-ethyl-7,17-dihydroxy-8,16-dimethoxy-4-oxa-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),5,7,9,14,16,18,20-nonaen-3-one |
| SMILES | CCn1c2c3cc(OC)c(O)cc3ccc2c2c(=O)oc3cc(O)c(OC)cc3c21 |
| InChI | InChI=1S/C23H19NO6/c1-4-24-21-12(6-5-11-7-15(25)18(28-2)8-13(11)21)20-22(24)14-9-19(29-3)16(26)10-17(14)30-23(20)27/h5-10,25-26H,4H2,1-3H3 |
| InChIKey | VZJCRYLXTNYFIB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|