C29H28N4O3 — CID 59054591
benzyl (2R)-1-[[4-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)phenyl]methyl]pyrrolidine-2-carboxylate (PubChem CID 59054591) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is benzyl (2R)-1-[[4-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)phenyl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2R)-1-[[4-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)phenyl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59054591 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | benzyl (2R)-1-[[4-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)phenyl]methyl]pyrrolidine-2-carboxylate |
| SMILES | O=C1NCCn2c(-c3ccc(CN4CCC[C@@H]4C(=O)OCc4ccccc4)cc3)nc3cccc1c32 |
| InChI | InChI=1S/C29H28N4O3/c34-28-23-8-4-9-24-26(23)33(17-15-30-28)27(31-24)22-13-11-20(12-14-22)18-32-16-5-10-25(32)29(35)36-19-21-6-2-1-3-7-21/h1-4,6-9,11-14,25H,5,10,15-19H2,(H,30,34)/t25-/m1/s1 |
| InChIKey | ONZCVVFQAVJCRJ-RUZDIDTESA-N |
| XLogP | 4.15 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |