C20H11N5 — CID 59055237
(5E)-5-benzylidene-6-isocyano-2-phenylpyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile (PubChem CID 59055237) has the molecular formula C20H11N5 and a molecular weight of 321.34 g/mol. Its IUPAC name is (5E)-5-benzylidene-6-isocyano-2-phenylpyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile.
| Compound Name | (5E)-5-benzylidene-6-isocyano-2-phenylpyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile |
|---|---|
| PubChem CID | 59055237 |
| Molecular Formula | C20H11N5 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (5E)-5-benzylidene-6-isocyano-2-phenylpyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c2nc(-c3ccccc3)nn2/c1=C/c1ccccc1 |
| InChI | InChI=1S/C20H11N5/c1-22-18-16(13-21)20-23-19(15-10-6-3-7-11-15)24-25(20)17(18)12-14-8-4-2-5-9-14/h2-12H/b17-12+ |
| InChIKey | YEIGLANFYIONNX-SFQUDFHCSA-N |
| XLogP | 3.37 |
| TPSA | 58.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|