About 7,8-dihydro-1H-pteridine-2,4-dione
7,8-dihydro-1H-pteridine-2,4-dione (PubChem CID 590555) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 7,8-dihydro-1H-pteridine-2,4-dione.
Molecular Properties
| Compound Name | 7,8-dihydro-1H-pteridine-2,4-dione |
| PubChem CID | 590555 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 7,8-dihydro-1H-pteridine-2,4-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)N=CCN2 |
| InChI | InChI=1S/C6H6N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1H,2H2,(H3,8,9,10,11,12) |
| InChIKey | MYJNEEHZESREMO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dihydro-1H-pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-1H-pteridine-2,4-dione?
The IUPAC name of 7,8-dihydro-1H-pteridine-2,4-dione (CID 590555) is 7,8-dihydro-1H-pteridine-2,4-dione.
What is the SMILES notation for 7,8-dihydro-1H-pteridine-2,4-dione?
The canonical SMILES for 7,8-dihydro-1H-pteridine-2,4-dione is O=c1[nH]c2c(c(=O)[nH]1)N=CCN2.
What is the InChIKey of 7,8-dihydro-1H-pteridine-2,4-dione?
The InChIKey is MYJNEEHZESREMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1H,2H2,(H3,8,9,10,11,12).
What are the key properties of 7,8-dihydro-1H-pteridine-2,4-dione?
7,8-dihydro-1H-pteridine-2,4-dione has a molecular weight of 166.14 g/mol, XLogP of -0.81, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-1H-pteridine-2,4-dione is sourced from PubChem (CID 590555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).