About CID 59055911
CID 59055911 (PubChem CID 59055911) has the molecular formula C20H32
and a molecular weight of 272.48 g/mol.
Molecular Properties
| Compound Name | CID 59055911 |
| PubChem CID | 59055911 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | — |
| SMILES | CC1CC=C([C]2CCC([C]3CCC(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C20H32/c1-15-3-7-17(8-4-15)19-11-13-20(14-12-19)18-9-5-16(2)6-10-18/h7,15-16,20H,3-6,8-14H2,1-2H3 |
| InChIKey | JQFPCVXOXGDHMP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 59055911 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59055911?
The IUPAC name of CID 59055911 (CID 59055911) is not available.
What is the SMILES notation for CID 59055911?
The canonical SMILES for CID 59055911 is CC1CC=C([C]2CCC([C]3CCC(C)CC3)CC2)CC1.
What is the InChIKey of CID 59055911?
The InChIKey is JQFPCVXOXGDHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32/c1-15-3-7-17(8-4-15)19-11-13-20(14-12-19)18-9-5-16(2)6-10-18/h7,15-16,20H,3-6,8-14H2,1-2H3.
What are the key properties of CID 59055911?
CID 59055911 has a molecular weight of 272.48 g/mol, XLogP of 6.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59055911 is sourced from PubChem (CID 59055911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).