C21H25ClN5O5S2+ — CID 59056121
(E)-2-(5-chlorothiophen-2-yl)-N-[(3S)-1-[2-[(2S)-2-(1-hydroxypyrimidin-1-ium-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxopiperidin-3-yl]ethenesulfonamide (PubChem CID 59056121) has the molecular formula C21H25ClN5O5S2+ and a molecular weight of 527.05 g/mol. Its IUPAC name is (E)-2-(5-chlorothiophen-2-yl)-N-[(3S)-1-[2-[(2S)-2-(1-hydroxypyrimidin-1-ium-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxopiperidin-3-yl]ethenesulfonamide.
| Compound Name | (E)-2-(5-chlorothiophen-2-yl)-N-[(3S)-1-[2-[(2S)-2-(1-hydroxypyrimidin-1-ium-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxopiperidin-3-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 59056121 |
| Molecular Formula | C21H25ClN5O5S2+ |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | (E)-2-(5-chlorothiophen-2-yl)-N-[(3S)-1-[2-[(2S)-2-(1-hydroxypyrimidin-1-ium-2-yl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxopiperidin-3-yl]ethenesulfonamide |
| SMILES | O=C1[C@@H](NS(=O)(=O)/C=C/c2ccc(Cl)s2)CCCN1CC(=O)N1CCC[C@H]1c1nccc[n+]1O |
| InChI | InChI=1S/C21H25ClN5O5S2/c22-18-7-6-15(33-18)8-13-34(31,32)24-16-4-1-10-25(21(16)29)14-19(28)26-11-2-5-17(26)20-23-9-3-12-27(20)30/h3,6-9,12-13,16-17,24,30H,1-2,4-5,10-11,14H2/q+1/b13-8+/t16-,17-/m0/s1 |
| InChIKey | VAGINLZMBLLLKS-XRTOLVASSA-N |
| XLogP | 1.57 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|