About 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one
1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one (PubChem CID 59057322) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one |
| PubChem CID | 59057322 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one |
| SMILES | Cc1ccc(CC2CN(Cc3ccccc3)C(=O)N2)cc1C |
| InChI | InChI=1S/C19H22N2O/c1-14-8-9-17(10-15(14)2)11-18-13-21(19(22)20-18)12-16-6-4-3-5-7-16/h3-10,18H,11-13H2,1-2H3,(H,20,22) |
| InChIKey | REKICTPKQITCOV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one?
The IUPAC name of 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one (CID 59057322) is 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one.
What is the SMILES notation for 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one?
The canonical SMILES for 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one is Cc1ccc(CC2CN(Cc3ccccc3)C(=O)N2)cc1C.
What is the InChIKey of 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one?
The InChIKey is REKICTPKQITCOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O/c1-14-8-9-17(10-15(14)2)11-18-13-21(19(22)20-18)12-16-6-4-3-5-7-16/h3-10,18H,11-13H2,1-2H3,(H,20,22).
What are the key properties of 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one?
1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one has a molecular weight of 294.40 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[(3,4-dimethylphenyl)methyl]imidazolidin-2-one is sourced from PubChem (CID 59057322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).