C25H26N4O2 — CID 59057560
4-[5-[4-(aminomethoxy)phenyl]-4-(4-methoxyphenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline (PubChem CID 59057560) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[5-[4-(aminomethoxy)phenyl]-4-(4-methoxyphenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-[4-(aminomethoxy)phenyl]-4-(4-methoxyphenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59057560 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[5-[4-(aminomethoxy)phenyl]-4-(4-methoxyphenyl)-1H-imidazol-2-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-c2nc(-c3ccc(N(C)C)cc3)[nH]c2-c2ccc(OCN)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-29(2)20-10-4-19(5-11-20)25-27-23(17-6-12-21(30-3)13-7-17)24(28-25)18-8-14-22(15-9-18)31-16-26/h4-15H,16,26H2,1-3H3,(H,27,28) |
| InChIKey | GCOFCFWFXXRSNB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|