C22H23Br2N5O3 — CID 59057721
N-[2-[(4,6-dibromo-2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-5-[ethyl(propan-2-yl)amino]phenyl]acetamide (PubChem CID 59057721) has the molecular formula C22H23Br2N5O3 and a molecular weight of 565.27 g/mol. Its IUPAC name is N-[2-[(4,6-dibromo-2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-5-[ethyl(propan-2-yl)amino]phenyl]acetamide.
| Compound Name | N-[2-[(4,6-dibromo-2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-5-[ethyl(propan-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 59057721 |
| Molecular Formula | C22H23Br2N5O3 |
| Molecular Weight | 565.27 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | N-[2-[(4,6-dibromo-2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-5-[ethyl(propan-2-yl)amino]phenyl]acetamide |
| SMILES | CCN(c1ccc(/N=N/c2c(Br)cc3c(c2Br)C(=O)N(C)C3=O)c(NC(C)=O)c1)C(C)C |
| InChI | InChI=1S/C22H23Br2N5O3/c1-6-29(11(2)3)13-7-8-16(17(9-13)25-12(4)30)26-27-20-15(23)10-14-18(19(20)24)22(32)28(5)21(14)31/h7-11H,6H2,1-5H3,(H,25,30)/b27-26+ |
| InChIKey | NGQKCJXEMZNZKU-CYYJNZCTSA-N |
| XLogP | 6.05 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|