C21H21F6N2O+ — CID 59058153
(5R)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2,3-dimethyl-5-phenyl-1,4-dihydroimidazol-3-ium (PubChem CID 59058153) has the molecular formula C21H21F6N2O+ and a molecular weight of 431.40 g/mol. Its IUPAC name is (5R)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2,3-dimethyl-5-phenyl-1,4-dihydroimidazol-3-ium.
| Compound Name | (5R)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2,3-dimethyl-5-phenyl-1,4-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 59058153 |
| Molecular Formula | C21H21F6N2O+ |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (5R)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2,3-dimethyl-5-phenyl-1,4-dihydroimidazol-3-ium |
| SMILES | CC1=[N+](C)C[C@@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)N1 |
| InChI | InChI=1S/C21H20F6N2O/c1-14-28-19(12-29(14)2,16-6-4-3-5-7-16)13-30-11-15-8-17(20(22,23)24)10-18(9-15)21(25,26)27/h3-10H,11-13H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | MCTKZBNMHKBTEJ-LJQANCHMSA-O |
| XLogP | 4.80 |
| TPSA | 24.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|