C6H13NO2S — CID 59058282
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]thiohydroxylamine (PubChem CID 59058282) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]thiohydroxylamine.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 59058282 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]thiohydroxylamine |
| SMILES | CC1(C)OCC(CNS)O1 |
| InChI | InChI=1S/C6H13NO2S/c1-6(2)8-4-5(9-6)3-7-10/h5,7,10H,3-4H2,1-2H3 |
| InChIKey | UXEOXGAXINORNL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|