C17H31N5O4 — CID 59058308
6-cyclohexyl-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 59058308) has the molecular formula C17H31N5O4 and a molecular weight of 369.47 g/mol. Its IUPAC name is 6-cyclohexyl-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclohexyl-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59058308 |
| Molecular Formula | C17H31N5O4 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 6-cyclohexyl-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCN(COC)c1nc(C2CCCCC2)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C17H31N5O4/c1-23-10-21(11-24-2)16-18-15(14-8-6-5-7-9-14)19-17(20-16)22(12-25-3)13-26-4/h14H,5-13H2,1-4H3 |
| InChIKey | YDAGWDJNXPLZDL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|