C22H19NO — CID 59058540
(5R)-2-methyl-4,4,5-triphenyl-5H-1,3-oxazole (PubChem CID 59058540) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is (5R)-2-methyl-4,4,5-triphenyl-5H-1,3-oxazole.
| Compound Name | (5R)-2-methyl-4,4,5-triphenyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 59058540 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (5R)-2-methyl-4,4,5-triphenyl-5H-1,3-oxazole |
| SMILES | CC1=NC(c2ccccc2)(c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C22H19NO/c1-17-23-22(19-13-7-3-8-14-19,20-15-9-4-10-16-20)21(24-17)18-11-5-2-6-12-18/h2-16,21H,1H3/t21-/m1/s1 |
| InChIKey | VYLYTGOUEKVTNY-OAQYLSRUSA-N |
| XLogP | 5.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |