C25H22N2O7S2 — CID 59058661
3-[2-[[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 59058661) has the molecular formula C25H22N2O7S2 and a molecular weight of 526.59 g/mol. Its IUPAC name is 3-[2-[[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59058661 |
| Molecular Formula | C25H22N2O7S2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 3-[2-[[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | COc1ccc2c(c1)N(CC(=O)O)C(=Cc1oc3ccc4ccccc4c3[n+]1CCCS(=O)(=O)[O-])S2 |
| InChI | InChI=1S/C25H22N2O7S2/c1-33-17-8-10-21-19(13-17)27(15-24(28)29)23(35-21)14-22-26(11-4-12-36(30,31)32)25-18-6-3-2-5-16(18)7-9-20(25)34-22/h2-3,5-10,13-14H,4,11-12,15H2,1H3,(H-,28,29,30,31,32) |
| InChIKey | QNFKPBDEKQTMLI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|