About N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide
N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide (PubChem CID 59058834) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide.
Molecular Properties
| Compound Name | N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide |
| PubChem CID | 59058834 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide |
| SMILES | CCc1nc(C)c(N(C)C=O)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-4-7-9-6(2)8(12-7)10(3)5-11/h5H,4H2,1-3H3 |
| InChIKey | AXKVIOKXDRGTOL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide?
The IUPAC name of N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide (CID 59058834) is N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide.
What is the SMILES notation for N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide?
The canonical SMILES for N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide is CCc1nc(C)c(N(C)C=O)s1.
What is the InChIKey of N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide?
The InChIKey is AXKVIOKXDRGTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-4-7-9-6(2)8(12-7)10(3)5-11/h5H,4H2,1-3H3.
What are the key properties of N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide?
N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide has a molecular weight of 184.26 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-N-methylformamide is sourced from PubChem (CID 59058834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).