About actinium;(5-methyltetrazol-2-yl)methanol
actinium;(5-methyltetrazol-2-yl)methanol (PubChem CID 59058893) has the molecular formula C3H6AcN4O
and a molecular weight of 341.11 g/mol. Its IUPAC name is actinium;(5-methyltetrazol-2-yl)methanol.
Molecular Properties
| Compound Name | actinium;(5-methyltetrazol-2-yl)methanol |
| PubChem CID | 59058893 |
| Molecular Formula | C3H6AcN4O |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | actinium;(5-methyltetrazol-2-yl)methanol |
| SMILES | Cc1nnn(CO)n1.[Ac] |
| InChI | InChI=1S/C3H6N4O.Ac/c1-3-4-6-7(2-8)5-3;/h8H,2H2,1H3; |
| InChIKey | LDMZSYOTZXNDGJ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze actinium;(5-methyltetrazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;(5-methyltetrazol-2-yl)methanol?
The IUPAC name of actinium;(5-methyltetrazol-2-yl)methanol (CID 59058893) is actinium;(5-methyltetrazol-2-yl)methanol.
What is the SMILES notation for actinium;(5-methyltetrazol-2-yl)methanol?
The canonical SMILES for actinium;(5-methyltetrazol-2-yl)methanol is Cc1nnn(CO)n1.[Ac].
What is the InChIKey of actinium;(5-methyltetrazol-2-yl)methanol?
The InChIKey is LDMZSYOTZXNDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O.Ac/c1-3-4-6-7(2-8)5-3;/h8H,2H2,1H3;.
What are the key properties of actinium;(5-methyltetrazol-2-yl)methanol?
actinium;(5-methyltetrazol-2-yl)methanol has a molecular weight of 341.11 g/mol, XLogP of -1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;(5-methyltetrazol-2-yl)methanol is sourced from PubChem (CID 59058893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).