About 2-bromo-5-butylfuran
2-bromo-5-butylfuran (PubChem CID 59059059) has the molecular formula C8H11BrO
and a molecular weight of 203.08 g/mol. Its IUPAC name is 2-bromo-5-butylfuran.
Molecular Properties
| Compound Name | 2-bromo-5-butylfuran |
| PubChem CID | 59059059 |
| Molecular Formula | C8H11BrO |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2-bromo-5-butylfuran |
| SMILES | CCCCc1ccc(Br)o1 |
| InChI | InChI=1S/C8H11BrO/c1-2-3-4-7-5-6-8(9)10-7/h5-6H,2-4H2,1H3 |
| InChIKey | GVTKNPGITLKFQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-5-butylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-butylfuran?
The IUPAC name of 2-bromo-5-butylfuran (CID 59059059) is 2-bromo-5-butylfuran.
What is the SMILES notation for 2-bromo-5-butylfuran?
The canonical SMILES for 2-bromo-5-butylfuran is CCCCc1ccc(Br)o1.
What is the InChIKey of 2-bromo-5-butylfuran?
The InChIKey is GVTKNPGITLKFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrO/c1-2-3-4-7-5-6-8(9)10-7/h5-6H,2-4H2,1H3.
What are the key properties of 2-bromo-5-butylfuran?
2-bromo-5-butylfuran has a molecular weight of 203.08 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-butylfuran is sourced from PubChem (CID 59059059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).