About 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone
1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone (PubChem CID 59059063) has the molecular formula C7H6F3NOS
and a molecular weight of 209.19 g/mol. Its IUPAC name is 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone.
Analyze 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone (CID 59059063) is 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone is CCc1cnc(C(=O)C(F)(F)F)s1.
What is the InChIKey of 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone?
The InChIKey is BYKNSHOMWIZFSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NOS/c1-2-4-3-11-6(13-4)5(12)7(8,9)10/h3H,2H2,1H3.
What are the key properties of 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone?
1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone has a molecular weight of 209.19 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-1,3-thiazol-2-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 59059063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).