C23H32O5Si — CID 59059482
10-O-propyl 9-O-(2-trimethylsilylethyl) (1S,9R,10R)-4-hydroxy-11-methylidenetricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059482) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1S,9R,10R)-4-hydroxy-11-methylidenetricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1S,9R,10R)-4-hydroxy-11-methylidenetricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059482 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1S,9R,10R)-4-hydroxy-11-methylidenetricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | C=C1CC2c3ccc(O)cc3[C@H]1[C@@H](C(=O)OCCC)[C@@H]2C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C23H32O5Si/c1-6-9-27-23(26)21-19-14(2)12-17(16-8-7-15(24)13-18(16)19)20(21)22(25)28-10-11-29(3,4)5/h7-8,13,17,19-21,24H,2,6,9-12H2,1,3-5H3/t17?,19-,20+,21+/m0/s1 |
| InChIKey | UIOIMWCFYPDQQX-BHKJNBGTSA-N |
| XLogP | 4.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|