C23H32N2O7Si — CID 59059531
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-11-carbamoyloxyimino-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059531) has the molecular formula C23H32N2O7Si and a molecular weight of 476.60 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-11-carbamoyloxyimino-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-11-carbamoyloxyimino-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059531 |
| Molecular Formula | C23H32N2O7Si |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-11-carbamoyloxyimino-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)[C@H]1[C@H](C(=O)OCC[Si](C)(C)C)C2CC(=NOC(N)=O)[C@H]1c1cc(O)ccc12 |
| InChI | InChI=1S/C23H32N2O7Si/c1-5-8-30-22(28)20-18-15-11-13(26)6-7-14(15)16(12-17(18)25-32-23(24)29)19(20)21(27)31-9-10-33(2,3)4/h6-7,11,16,18-20,26H,5,8-10,12H2,1-4H3,(H2,24,29)/t16?,18-,19-,20-/m1/s1 |
| InChIKey | CRXNWUYTWKKPIG-FESZSOIMSA-N |
| XLogP | 3.49 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|