C29H35FO6Si — CID 59059540
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R)-4-[(3-fluorophenyl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059540) has the molecular formula C29H35FO6Si and a molecular weight of 526.68 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R)-4-[(3-fluorophenyl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R)-4-[(3-fluorophenyl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059540 |
| Molecular Formula | C29H35FO6Si |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,10R)-4-[(3-fluorophenyl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)[C@H]1C(C(=O)OCC[Si](C)(C)C)C2CC(=O)[C@H]1c1cc(OCc3cccc(F)c3)ccc12 |
| InChI | InChI=1S/C29H35FO6Si/c1-5-11-34-29(33)27-25-22-15-20(36-17-18-7-6-8-19(30)14-18)9-10-21(22)23(16-24(25)31)26(27)28(32)35-12-13-37(2,3)4/h6-10,14-15,23,25-27H,5,11-13,16-17H2,1-4H3/t23?,25-,26?,27-/m1/s1 |
| InChIKey | CNNBIVTZUZXXKD-UDVZQLPGSA-N |
| XLogP | 5.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|