C26H29FO6Si — CID 59059565
10-O-[(3-fluorophenyl)methyl] 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059565) has the molecular formula C26H29FO6Si and a molecular weight of 484.60 g/mol. Its IUPAC name is 10-O-[(3-fluorophenyl)methyl] 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-[(3-fluorophenyl)methyl] 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059565 |
| Molecular Formula | C26H29FO6Si |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 10-O-[(3-fluorophenyl)methyl] 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)[C@@H]1C2CC(=O)[C@@H](c3cc(O)ccc32)[C@H]1C(=O)OCc1cccc(F)c1 |
| InChI | InChI=1S/C26H29FO6Si/c1-34(2,3)10-9-32-25(30)23-20-13-21(29)22(19-12-17(28)7-8-18(19)20)24(23)26(31)33-14-15-5-4-6-16(27)11-15/h4-8,11-12,20,22-24,28H,9-10,13-14H2,1-3H3/t20?,22-,23-,24-/m1/s1 |
| InChIKey | HARHJEIXHQYICQ-AYFDPRGUSA-N |
| XLogP | 4.54 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|