C27H35NO7Si — CID 59059588
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059588) has the molecular formula C27H35NO7Si and a molecular weight of 513.66 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059588 |
| Molecular Formula | C27H35NO7Si |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)[C@H]1[C@H](C(=O)OCC[Si](C)(C)C)C2CC(=O)[C@H]1c1cc(OCc3cc(C)on3)ccc12 |
| InChI | InChI=1S/C27H35NO7Si/c1-6-9-32-27(31)25-23-20-13-18(34-15-17-12-16(2)35-28-17)7-8-19(20)21(14-22(23)29)24(25)26(30)33-10-11-36(3,4)5/h7-8,12-13,21,23-25H,6,9-11,14-15H2,1-5H3/t21?,23-,24-,25-/m1/s1 |
| InChIKey | WRSQNWIWXPWLSW-LGIKCHEVSA-N |
| XLogP | 4.78 |
| TPSA | 104.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|