C23H34N2O7SSi — CID 59059635
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-(methylsulfonylhydrazinylidene)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 59059635) has the molecular formula C23H34N2O7SSi and a molecular weight of 510.69 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-(methylsulfonylhydrazinylidene)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-(methylsulfonylhydrazinylidene)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 59059635 |
| Molecular Formula | C23H34N2O7SSi |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R)-4-hydroxy-11-(methylsulfonylhydrazinylidene)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)[C@H]1[C@H](C(=O)OCC[Si](C)(C)C)C2CC(=NNS(C)(=O)=O)[C@H]1c1cc(O)ccc12 |
| InChI | InChI=1S/C23H34N2O7SSi/c1-6-9-31-23(28)21-19-16-12-14(26)7-8-15(16)17(13-18(19)24-25-33(2,29)30)20(21)22(27)32-10-11-34(3,4)5/h7-8,12,17,19-21,25-26H,6,9-11,13H2,1-5H3/t17?,19-,20-,21-/m1/s1 |
| InChIKey | DJFFFPGYIQWBQZ-HCUUGGHISA-N |
| XLogP | 2.95 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|