C46H66N4O4 — CID 59059650
3-[2-[2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-(2-phenylpropyl)pyrrolidin-3-yl]-2-phenylethyl]-4-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 59059650) has the molecular formula C46H66N4O4 and a molecular weight of 739.06 g/mol. Its IUPAC name is 3-[2-[2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-(2-phenylpropyl)pyrrolidin-3-yl]-2-phenylethyl]-4-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[2-[2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-(2-phenylpropyl)pyrrolidin-3-yl]-2-phenylethyl]-4-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59059650 |
| Molecular Formula | C46H66N4O4 |
| Molecular Weight | 739.06 g/mol |
| Exact Mass | 738.51 |
| IUPAC Name | 3-[2-[2,5-dioxo-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-(2-phenylpropyl)pyrrolidin-3-yl]-2-phenylethyl]-4-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC(CC1C(=O)N(C2CC(C)(C)N(C)C(C)(C)C2)C(=O)C1C(CC1C(=O)N(C2CC(C)(C)N(C)C(C)(C)C2)C(=O)C1C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H66N4O4/c1-29(31-19-15-13-16-20-31)23-37-38(42(54)50(41(37)53)34-27-45(7,8)48(12)46(9,10)28-34)36(32-21-17-14-18-22-32)24-35-30(2)39(51)49(40(35)52)33-25-43(3,4)47(11)44(5,6)26-33/h13-22,29-30,33-38H,23-28H2,1-12H3 |
| InChIKey | NIFYWMAXZWLQHX-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.06 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|