About CID 59059654
CID 59059654 (PubChem CID 59059654) has the molecular formula C14H8BF5N2O3
and a molecular weight of 358.03 g/mol.
Molecular Properties
| Compound Name | CID 59059654 |
| PubChem CID | 59059654 |
| Molecular Formula | C14H8BF5N2O3 |
| Molecular Weight | 358.03 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | — |
| SMILES | [B]C(=O)n1cnc(CC(C)C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H8BF5N2O3/c1-5(2-6-3-22(4-21-6)14(15)24)13(23)25-12-10(19)8(17)7(16)9(18)11(12)20/h3-5H,2H2,1H3 |
| InChIKey | WGTIQIPJHOBUDH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.03 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 59059654 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59059654?
The IUPAC name of CID 59059654 (CID 59059654) is not available.
What is the SMILES notation for CID 59059654?
The canonical SMILES for CID 59059654 is [B]C(=O)n1cnc(CC(C)C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c1.
What is the InChIKey of CID 59059654?
The InChIKey is WGTIQIPJHOBUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BF5N2O3/c1-5(2-6-3-22(4-21-6)14(15)24)13(23)25-12-10(19)8(17)7(16)9(18)11(12)20/h3-5H,2H2,1H3.
What are the key properties of CID 59059654?
CID 59059654 has a molecular weight of 358.03 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59059654 is sourced from PubChem (CID 59059654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).