C16H28F8N2 — CID 59059933
3,3,4,4,5,5,6,6-octafluoro-N,N'-dimethyl-N,N'-di(propan-2-yl)octane-1,8-diamine (PubChem CID 59059933) has the molecular formula C16H28F8N2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-N,N'-dimethyl-N,N'-di(propan-2-yl)octane-1,8-diamine.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-N,N'-dimethyl-N,N'-di(propan-2-yl)octane-1,8-diamine |
|---|---|
| PubChem CID | 59059933 |
| Molecular Formula | C16H28F8N2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-N,N'-dimethyl-N,N'-di(propan-2-yl)octane-1,8-diamine |
| SMILES | CC(C)N(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCN(C)C(C)C |
| InChI | InChI=1S/C16H28F8N2/c1-11(2)25(5)9-7-13(17,18)15(21,22)16(23,24)14(19,20)8-10-26(6)12(3)4/h11-12H,7-10H2,1-6H3 |
| InChIKey | YRCSYJDZUVQMOI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|