C10H12NY- — CID 59059995
2,3-dimethyl-4,4a,7,7a-tetrahydrocyclopenta[b]pyridin-4-ide;yttrium (PubChem CID 59059995) has the molecular formula C10H12NY- and a molecular weight of 235.12 g/mol. Its IUPAC name is 2,3-dimethyl-4,4a,7,7a-tetrahydrocyclopenta[b]pyridin-4-ide;yttrium.
| Compound Name | 2,3-dimethyl-4,4a,7,7a-tetrahydrocyclopenta[b]pyridin-4-ide;yttrium |
|---|---|
| PubChem CID | 59059995 |
| Molecular Formula | C10H12NY- |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 2,3-dimethyl-4,4a,7,7a-tetrahydrocyclopenta[b]pyridin-4-ide;yttrium |
| SMILES | CC1=[C-]C2C=CCC2N=C1C.[Y] |
| InChI | InChI=1S/C10H12N.Y/c1-7-6-9-4-3-5-10(9)11-8(7)2;/h3-4,9-10H,5H2,1-2H3;/q-1; |
| InChIKey | UFKZNGPNZLKUKQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|