About (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide
(2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide (PubChem CID 59060117) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide.
Molecular Properties
| Compound Name | (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide |
| PubChem CID | 59060117 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide |
| SMILES | CCC[C@H](C(N)=O)[C@@H](CC(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-7-8-11(14(16)18)12(9-10(2)3)13(17)15(4,5)6/h10-12H,7-9H2,1-6H3,(H2,16,18)/t11-,12+/m0/s1 |
| InChIKey | QVHZWGPDZUPERP-NWDGAFQWSA-N |
| XLogP | 3.17 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide?
The IUPAC name of (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide (CID 59060117) is (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide.
What is the SMILES notation for (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide?
The canonical SMILES for (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide is CCC[C@H](C(N)=O)[C@@H](CC(C)C)C(=O)C(C)(C)C.
What is the InChIKey of (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide?
The InChIKey is QVHZWGPDZUPERP-NWDGAFQWSA-N. The full InChI is InChI=1S/C15H29NO2/c1-7-8-11(14(16)18)12(9-10(2)3)13(17)15(4,5)6/h10-12H,7-9H2,1-6H3,(H2,16,18)/t11-,12+/m0/s1.
What are the key properties of (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide?
(2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide has a molecular weight of 255.40 g/mol, XLogP of 3.17, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-5,5-dimethyl-3-(2-methylpropyl)-4-oxo-2-propylhexanamide is sourced from PubChem (CID 59060117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).