C30H38AcO9 — CID 59060242
[(1S,2S,4S,7R,9S,10S,12R,15S)-4-acetyloxy-1,9,12-trihydroxy-10,14,15,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate;actinium (PubChem CID 59060242) has the molecular formula C30H38AcO9 and a molecular weight of 769.62 g/mol. Its IUPAC name is [(1S,2S,4S,7R,9S,10S,12R,15S)-4-acetyloxy-1,9,12-trihydroxy-10,14,15,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate;actinium.
| Compound Name | [(1S,2S,4S,7R,9S,10S,12R,15S)-4-acetyloxy-1,9,12-trihydroxy-10,14,15,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate;actinium |
|---|---|
| PubChem CID | 59060242 |
| Molecular Formula | C30H38AcO9 |
| Molecular Weight | 769.62 g/mol |
| Exact Mass | 769.28 |
| IUPAC Name | [(1S,2S,4S,7R,9S,10S,12R,15S)-4-acetyloxy-1,9,12-trihydroxy-10,14,15,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate;actinium |
| SMILES | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](C)C[C@@](O)(C(OC(=O)c4ccccc4)C12)C3(C)C.[Ac] |
| InChI | InChI=1S/C30H38O9.Ac/c1-15-13-30(36)25(38-26(35)18-10-8-7-9-11-18)23-28(6,24(34)22(33)21(16(15)2)27(30,4)5)19(32)12-20-29(23,14-37-20)39-17(3)31;/h7-11,15,19-20,22-23,25,32-33,36H,12-14H2,1-6H3;/t15-,19-,20+,22+,23?,25?,28+,29-,30+;/m0./s1 |
| InChIKey | BOLYZHMKILMWGO-SWKRMYMPSA-N |
| XLogP | 2.36 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|