C10H13NOY — CID 59060836
2,3,4,6-tetrahydrochromen-1-ium-6-id-2-ylmethanamine;yttrium (PubChem CID 59060836) has the molecular formula C10H13NOY and a molecular weight of 252.13 g/mol. Its IUPAC name is 2,3,4,6-tetrahydrochromen-1-ium-6-id-2-ylmethanamine;yttrium.
| Compound Name | 2,3,4,6-tetrahydrochromen-1-ium-6-id-2-ylmethanamine;yttrium |
|---|---|
| PubChem CID | 59060836 |
| Molecular Formula | C10H13NOY |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2,3,4,6-tetrahydrochromen-1-ium-6-id-2-ylmethanamine;yttrium |
| SMILES | NCC1CCc2c[c-]ccc2[OH+]1.[Y] |
| InChI | InChI=1S/C10H12NO.Y/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;/h2-4,9H,5-7,11H2;/q-1;/p+1 |
| InChIKey | JVLQAFRJDQQTRO-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|