C32H42IO6- — CID 59061654
1-O-[2-[4-(4-methylphenyl)iodanuidylphenoxy]ethyl] 5-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 59061654) has the molecular formula C32H42IO6- and a molecular weight of 649.59 g/mol. Its IUPAC name is 1-O-[2-[4-(4-methylphenyl)iodanuidylphenoxy]ethyl] 5-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-[4-(4-methylphenyl)iodanuidylphenoxy]ethyl] 5-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59061654 |
| Molecular Formula | C32H42IO6- |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | 1-O-[2-[4-(4-methylphenyl)iodanuidylphenoxy]ethyl] 5-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCOc1ccc([I-]c2ccc(C)cc2)cc1)C(=O)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C32H42IO6/c1-6-32(5,30(35)38-20-23-9-16-27-28(19-23)39-27)21-31(3,4)29(34)37-18-17-36-26-14-12-25(13-15-26)33-24-10-7-22(2)8-11-24/h7-8,10-15,23,27-28H,6,9,16-21H2,1-5H3/q-1 |
| InChIKey | UPVCMHCWPQTBQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|