C10H15N2+ — CID 59061811
9-(deuterioamino)nona-2,4,6,8-tetraenylidene-methylazanium (PubChem CID 59061811) has the molecular formula C10H15N2+ and a molecular weight of 164.25 g/mol. Its IUPAC name is 9-(deuterioamino)nona-2,4,6,8-tetraenylidene-methylazanium.
| Compound Name | 9-(deuterioamino)nona-2,4,6,8-tetraenylidene-methylazanium |
|---|---|
| PubChem CID | 59061811 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 9-(deuterioamino)nona-2,4,6,8-tetraenylidene-methylazanium |
| SMILES | [2H]NC=CC=CC=CC=C/C=[NH+]/C |
| InChI | InChI=1S/C10H14N2/c1-12-10-8-6-4-2-3-5-7-9-11/h2-10H,11H2,1H3/p+1/b4-2?,5-3?,8-6?,9-7?,12-10+/i/hD |
| InChIKey | GAOLBYADRBULQN-FDGHMIMUSA-O |
| XLogP | -0.09 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|