About 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium
4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium (PubChem CID 59061969) has the molecular formula C4H11N3O2
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium |
| PubChem CID | 59061969 |
| Molecular Formula | C4H11N3O2 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium |
| SMILES | CC1C(C)[NH+]([O-])N[NH+]1[O-] |
| InChI | InChI=1S/C4H11N3O2/c1-3-4(2)7(9)5-6(3)8/h3-7H,1-2H3 |
| InChIKey | XSIPIIBATQCKBH-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 67.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium?
The IUPAC name of 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium (CID 59061969) is 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium.
What is the SMILES notation for 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium?
The canonical SMILES for 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium is CC1C(C)[NH+]([O-])N[NH+]1[O-].
What is the InChIKey of 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium?
The InChIKey is XSIPIIBATQCKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O2/c1-3-4(2)7(9)5-6(3)8/h3-7H,1-2H3.
What are the key properties of 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium?
4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium has a molecular weight of 133.15 g/mol, XLogP of -3.04, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-dioxidotriazolidine-1,3-diium is sourced from PubChem (CID 59061969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).