C22H42N2Si — CID 59061993
N-[dimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silyl]-2-methylpropan-2-amine (PubChem CID 59061993) has the molecular formula C22H42N2Si and a molecular weight of 362.68 g/mol. Its IUPAC name is N-[dimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59061993 |
| Molecular Formula | C22H42N2Si |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 362.31 |
| IUPAC Name | N-[dimethyl-(8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-5-yl)silyl]-2-methylpropan-2-amine |
| SMILES | CC1CCC2C(C1)C1CC3CCCCC3C1N2[Si](C)(C)NC(C)(C)C |
| InChI | InChI=1S/C22H42N2Si/c1-15-11-12-20-18(13-15)19-14-16-9-7-8-10-17(16)21(19)24(20)25(5,6)23-22(2,3)4/h15-21,23H,7-14H2,1-6H3 |
| InChIKey | YNNHVHQGNKOPSP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|