C24H43NSi — CID 59061994
cyclopentyl-(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane (PubChem CID 59061994) has the molecular formula C24H43NSi and a molecular weight of 373.70 g/mol. Its IUPAC name is cyclopentyl-(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane.
| Compound Name | cyclopentyl-(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane |
|---|---|
| PubChem CID | 59061994 |
| Molecular Formula | C24H43NSi |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | cyclopentyl-(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane |
| SMILES | CC1CCC2C(C1)C1C3CCCCC3C([Si](C)(C)C3CCCC3)C1N2C |
| InChI | InChI=1S/C24H43NSi/c1-16-13-14-21-20(15-16)22-18-11-7-8-12-19(18)24(23(22)25(21)2)26(3,4)17-9-5-6-10-17/h16-24H,5-15H2,1-4H3 |
| InChIKey | HWSMJZQCDZIOMN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|