About [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate
[(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate (PubChem CID 59062060) has the molecular formula C12H20S2
and a molecular weight of 228.43 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate.
Molecular Properties
| Compound Name | [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate |
| PubChem CID | 59062060 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C[C@@H]1SC(C)=S |
| InChI | InChI=1S/C12H20S2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11+,12+/m1/s1 |
| InChIKey | AEHOBQZWODVJCN-USWWRNFRSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate?
The IUPAC name of [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate (CID 59062060) is [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate.
What is the SMILES notation for [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate?
The canonical SMILES for [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate is C=C(C)[C@@H]1CC[C@@H](C)C[C@@H]1SC(C)=S.
What is the InChIKey of [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate?
The InChIKey is AEHOBQZWODVJCN-USWWRNFRSA-N. The full InChI is InChI=1S/C12H20S2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11+,12+/m1/s1.
What are the key properties of [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate?
[(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate has a molecular weight of 228.43 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl] ethanedithioate is sourced from PubChem (CID 59062060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).