About (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane
(5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane (PubChem CID 59062063) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane.
Molecular Properties
| Compound Name | (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane |
| PubChem CID | 59062063 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane |
| SMILES | CCC1(C)CS[C@H](C)CO1 |
| InChI | InChI=1S/C8H16OS/c1-4-8(3)6-10-7(2)5-9-8/h7H,4-6H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | FVCYXYCDZZBCOG-GVHYBUMESA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane?
The IUPAC name of (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane (CID 59062063) is (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane.
What is the SMILES notation for (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane?
The canonical SMILES for (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane is CCC1(C)CS[C@H](C)CO1.
What is the InChIKey of (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane?
The InChIKey is FVCYXYCDZZBCOG-GVHYBUMESA-N. The full InChI is InChI=1S/C8H16OS/c1-4-8(3)6-10-7(2)5-9-8/h7H,4-6H2,1-3H3/t7-,8?/m1/s1.
What are the key properties of (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane?
(5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane has a molecular weight of 160.28 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-ethyl-2,5-dimethyl-1,4-oxathiane is sourced from PubChem (CID 59062063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).