About CID 59062208
CID 59062208 (PubChem CID 59062208) has the molecular formula C24H37BO3PS
and a molecular weight of 450.42 g/mol.
Molecular Properties
| Compound Name | CID 59062208 |
| PubChem CID | 59062208 |
| Molecular Formula | C24H37BO3PS |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | — |
| SMILES | [2H]P([B][3H])SOCC1CC([C@@H]2C(COC)[C@@H]3C=C[C@H]2C3)CC1[C@H]1C(COC)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C24H37BO3PS/c1-26-12-21-14-3-5-16(7-14)23(21)18-9-19(11-28-30-29-25)20(10-18)24-17-6-4-15(8-17)22(24)13-27-2/h3-6,14-25,29H,7-13H2,1-2H3/t14-,15+,16+,17-,18?,19?,20?,21?,22?,23-,24+,29?/m1/s1/i25T,29D |
| InChIKey | YVLIOWVIGFVPNW-OOPPZBJLSA-N |
| XLogP | 4.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59062208 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59062208?
The IUPAC name of CID 59062208 (CID 59062208) is not available.
What is the SMILES notation for CID 59062208?
The canonical SMILES for CID 59062208 is [2H]P([B][3H])SOCC1CC([C@@H]2C(COC)[C@@H]3C=C[C@H]2C3)CC1[C@H]1C(COC)[C@H]2C=C[C@@H]1C2.
What is the InChIKey of CID 59062208?
The InChIKey is YVLIOWVIGFVPNW-OOPPZBJLSA-N. The full InChI is InChI=1S/C24H37BO3PS/c1-26-12-21-14-3-5-16(7-14)23(21)18-9-19(11-28-30-29-25)20(10-18)24-17-6-4-15(8-17)22(24)13-27-2/h3-6,14-25,29H,7-13H2,1-2H3/t14-,15+,16+,17-,18?,19?,20?,21?,22?,23-,24+,29?/m1/s1/i25T,29D.
What are the key properties of CID 59062208?
CID 59062208 has a molecular weight of 450.42 g/mol, XLogP of 4.87, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59062208 is sourced from PubChem (CID 59062208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).