About actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide
actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide (PubChem CID 59063034) has the molecular formula C14H24AcNO2-
and a molecular weight of 465.35 g/mol. Its IUPAC name is actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide.
Molecular Properties
| Compound Name | actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide |
| PubChem CID | 59063034 |
| Molecular Formula | C14H24AcNO2- |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide |
| SMILES | CCC(CC)C([NH-])[C@@H]1C=C(C(=O)OC)C[C@H]1C.[Ac] |
| InChI | InChI=1S/C14H24NO2.Ac/c1-5-10(6-2)13(15)12-8-11(7-9(12)3)14(16)17-4;/h8-10,12-13,15H,5-7H2,1-4H3;/q-1;/t9-,12-,13?;/m1./s1 |
| InChIKey | IIUWTOGKNBJTQG-OCLUFJDDSA-N |
| XLogP | 3.60 |
| TPSA | 50.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide?
The IUPAC name of actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide (CID 59063034) is actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide.
What is the SMILES notation for actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide?
The canonical SMILES for actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide is CCC(CC)C([NH-])[C@@H]1C=C(C(=O)OC)C[C@H]1C.[Ac].
What is the InChIKey of actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide?
The InChIKey is IIUWTOGKNBJTQG-OCLUFJDDSA-N. The full InChI is InChI=1S/C14H24NO2.Ac/c1-5-10(6-2)13(15)12-8-11(7-9(12)3)14(16)17-4;/h8-10,12-13,15H,5-7H2,1-4H3;/q-1;/t9-,12-,13?;/m1./s1.
What are the key properties of actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide?
actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide has a molecular weight of 465.35 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;[2-ethyl-1-[(1S,5R)-3-methoxycarbonyl-5-methylcyclopent-2-en-1-yl]butyl]azanide is sourced from PubChem (CID 59063034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).