C13H23AcN4O2- — CID 59063044
actinium;[1-[(1S,5R)-3-carboxy-5-(diaminomethylideneamino)cyclopent-2-en-1-yl]-2-ethylbutyl]azanide (PubChem CID 59063044) has the molecular formula C13H23AcN4O2- and a molecular weight of 494.35 g/mol. Its IUPAC name is actinium;[1-[(1S,5R)-3-carboxy-5-(diaminomethylideneamino)cyclopent-2-en-1-yl]-2-ethylbutyl]azanide.
| Compound Name | actinium;[1-[(1S,5R)-3-carboxy-5-(diaminomethylideneamino)cyclopent-2-en-1-yl]-2-ethylbutyl]azanide |
|---|---|
| PubChem CID | 59063044 |
| Molecular Formula | C13H23AcN4O2- |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | actinium;[1-[(1S,5R)-3-carboxy-5-(diaminomethylideneamino)cyclopent-2-en-1-yl]-2-ethylbutyl]azanide |
| SMILES | CCC(CC)C([NH-])[C@@H]1C=C(C(=O)O)C[C@H]1N=C(N)N.[Ac] |
| InChI | InChI=1S/C13H23N4O2.Ac/c1-3-7(4-2)11(14)9-5-8(12(18)19)6-10(9)17-13(15)16;/h5,7,9-11,14H,3-4,6H2,1-2H3,(H,18,19)(H4,15,16,17);/q-1;/t9-,10-,11?;/m1./s1 |
| InChIKey | OCHHSMRPYXGLHN-MBXAJCBQSA-N |
| XLogP | 1.52 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|