About actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide
actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide (PubChem CID 59063062) has the molecular formula C15H27AcN2-
and a molecular weight of 462.40 g/mol. Its IUPAC name is actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide.
Molecular Properties
| Compound Name | actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide |
| PubChem CID | 59063062 |
| Molecular Formula | C15H27AcN2- |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide |
| SMILES | C=C(C)N[C@@H]1CC(C)=C[C@H]1C([NH-])C(CC)CC.[Ac] |
| InChI | InChI=1S/C15H27N2.Ac/c1-6-12(7-2)15(16)13-8-11(5)9-14(13)17-10(3)4;/h8,12-17H,3,6-7,9H2,1-2,4-5H3;/q-1;/t13-,14-,15?;/m1./s1 |
| InChIKey | DTYSWUMAEWEUDP-XBBYMFKQSA-N |
| XLogP | 4.30 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide?
The IUPAC name of actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide (CID 59063062) is actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide.
What is the SMILES notation for actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide?
The canonical SMILES for actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide is C=C(C)N[C@@H]1CC(C)=C[C@H]1C([NH-])C(CC)CC.[Ac].
What is the InChIKey of actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide?
The InChIKey is DTYSWUMAEWEUDP-XBBYMFKQSA-N. The full InChI is InChI=1S/C15H27N2.Ac/c1-6-12(7-2)15(16)13-8-11(5)9-14(13)17-10(3)4;/h8,12-17H,3,6-7,9H2,1-2,4-5H3;/q-1;/t13-,14-,15?;/m1./s1.
What are the key properties of actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide?
actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide has a molecular weight of 462.40 g/mol, XLogP of 4.30, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;[2-ethyl-1-[(1S,5R)-3-methyl-5-(prop-1-en-2-ylamino)cyclopent-2-en-1-yl]butyl]azanide is sourced from PubChem (CID 59063062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).